C15H17N3O5 — CID 166288894
[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(6-nitro-1,3-benzodioxol-5-yl)methanone (PubChem CID 166288894) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(6-nitro-1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(6-nitro-1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 166288894 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-(6-nitro-1,3-benzodioxol-5-yl)methanone |
| SMILES | O=C(c1cc2c(cc1[N+](=O)[O-])OCO2)N1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C15H17N3O5/c19-15(17-6-9-2-1-3-16-11(9)7-17)10-4-13-14(23-8-22-13)5-12(10)18(20)21/h4-5,9,11,16H,1-3,6-8H2/t9-,11+/m0/s1 |
| InChIKey | OSWMKIUVLVIDIK-GXSJLCMTSA-N |
| XLogP | 1.15 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|