C12H10ClN5O3 — CID 79831549
(3-chloro-2-nitrophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone (PubChem CID 79831549) has the molecular formula C12H10ClN5O3 and a molecular weight of 307.70 g/mol. Its IUPAC name is (3-chloro-2-nitrophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone.
| Compound Name | (3-chloro-2-nitrophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
|---|---|
| PubChem CID | 79831549 |
| Molecular Formula | C12H10ClN5O3 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | (3-chloro-2-nitrophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1[N+](=O)[O-])N1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H10ClN5O3/c13-9-3-1-2-8(11(9)18(20)21)12(19)16-4-5-17-7-14-15-10(17)6-16/h1-3,7H,4-6H2 |
| InChIKey | SZBRGWIBVCUYHU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|