C11H10FN5O — CID 115497926
6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(6-fluoro-2-pyridinyl)methanone (PubChem CID 115497926) has the molecular formula C11H10FN5O and a molecular weight of 247.23 g/mol. Its IUPAC name is 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(6-fluoro-2-pyridinyl)methanone.
| Compound Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(6-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 115497926 |
| Molecular Formula | C11H10FN5O |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-(6-fluoro-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(F)n1)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C11H10FN5O/c12-9-3-1-2-8(14-9)11(18)16-4-5-17-7-13-15-10(17)6-16/h1-3,7H,4-6H2 |
| InChIKey | LZVGNPRWMSPJGJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|