C10H11FN2O3 — CID 115498100
[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(6-fluoro-2-pyridinyl)methanone (PubChem CID 115498100) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(6-fluoro-2-pyridinyl)methanone.
| Compound Name | [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(6-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 115498100 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-(6-fluoro-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(F)n1)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H11FN2O3/c11-9-3-1-2-6(12-9)10(16)13-4-7(14)8(15)5-13/h1-3,7-8,14-15H,4-5H2/t7-,8+ |
| InChIKey | PISOOJOKFIMJPG-OCAPTIKFSA-N |
| XLogP | -0.60 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|