C14H19FN2O — CID 114592943
(6-fluoro-2-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone (PubChem CID 114592943) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is (6-fluoro-2-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone.
| Compound Name | (6-fluoro-2-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114592943 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (6-fluoro-2-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)C(C)N(C(=O)c2cccc(F)n2)C1 |
| InChI | InChI=1S/C14H19FN2O/c1-9-7-10(2)11(3)17(8-9)14(18)12-5-4-6-13(15)16-12/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | JUIDJJSOSZFNDD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|