C15H20F2N2O — CID 114591834
(2-amino-4,5-difluorophenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone (PubChem CID 114591834) has the molecular formula C15H20F2N2O and a molecular weight of 282.33 g/mol. Its IUPAC name is (2-amino-4,5-difluorophenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone.
| Compound Name | (2-amino-4,5-difluorophenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114591834 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2-amino-4,5-difluorophenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)C(C)N(C(=O)c2cc(F)c(F)cc2N)C1 |
| InChI | InChI=1S/C15H20F2N2O/c1-8-4-9(2)10(3)19(7-8)15(20)11-5-12(16)13(17)6-14(11)18/h5-6,8-10H,4,7,18H2,1-3H3 |
| InChIKey | QARRJTKCNFCEES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|