C15H20FNOS — CID 107036405
(4-fluoro-3-sulfanylphenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone (PubChem CID 107036405) has the molecular formula C15H20FNOS and a molecular weight of 281.40 g/mol. Its IUPAC name is (4-fluoro-3-sulfanylphenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone.
| Compound Name | (4-fluoro-3-sulfanylphenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107036405 |
| Molecular Formula | C15H20FNOS |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (4-fluoro-3-sulfanylphenyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)C(C)N(C(=O)c2ccc(F)c(S)c2)C1 |
| InChI | InChI=1S/C15H20FNOS/c1-9-6-10(2)11(3)17(8-9)15(18)12-4-5-13(16)14(19)7-12/h4-5,7,9-11,19H,6,8H2,1-3H3 |
| InChIKey | XEELFOKJOSZJFE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|