C13H14FNOS — CID 107025937
2-azabicyclo[2.2.1]heptan-2-yl-(4-fluoro-3-sulfanylphenyl)methanone (PubChem CID 107025937) has the molecular formula C13H14FNOS and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-azabicyclo[2.2.1]heptan-2-yl-(4-fluoro-3-sulfanylphenyl)methanone.
| Compound Name | 2-azabicyclo[2.2.1]heptan-2-yl-(4-fluoro-3-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107025937 |
| Molecular Formula | C13H14FNOS |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-azabicyclo[2.2.1]heptan-2-yl-(4-fluoro-3-sulfanylphenyl)methanone |
| SMILES | O=C(c1ccc(F)c(S)c1)N1CC2CCC1C2 |
| InChI | InChI=1S/C13H14FNOS/c14-11-4-2-9(6-12(11)17)13(16)15-7-8-1-3-10(15)5-8/h2,4,6,8,10,17H,1,3,5,7H2 |
| InChIKey | RUPBQTAPDKKVHE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|