C13H16FNO2S — CID 107036472
[(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluoro-3-sulfanylphenyl)methanone (PubChem CID 107036472) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluoro-3-sulfanylphenyl)methanone.
| Compound Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluoro-3-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107036472 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [(2R,6S)-2,6-dimethylmorpholin-4-yl]-(4-fluoro-3-sulfanylphenyl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(F)c(S)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H16FNO2S/c1-8-6-15(7-9(2)17-8)13(16)10-3-4-11(14)12(18)5-10/h3-5,8-9,18H,6-7H2,1-2H3/t8-,9+ |
| InChIKey | WPRDIEJQOZHMGB-DTORHVGOSA-N |
| XLogP | 2.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|