C14H21BrN4O — CID 114596633
(5-bromo-2-hydrazinyl-3-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone (PubChem CID 114596633) has the molecular formula C14H21BrN4O and a molecular weight of 341.25 g/mol. Its IUPAC name is (5-bromo-2-hydrazinyl-3-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone.
| Compound Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114596633 |
| Molecular Formula | C14H21BrN4O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-(2,3,5-trimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)C(C)N(C(=O)c2cc(Br)cnc2NN)C1 |
| InChI | InChI=1S/C14H21BrN4O/c1-8-4-9(2)10(3)19(7-8)14(20)12-5-11(15)6-17-13(12)18-16/h5-6,8-10H,4,7,16H2,1-3H3,(H,17,18) |
| InChIKey | TYZFRWBHBISLIO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|