C12H17BrN4O — CID 79187114
(5-bromo-2-hydrazinyl-3-pyridinyl)-(3,4-dimethylpyrrolidin-1-yl)methanone (PubChem CID 79187114) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is (5-bromo-2-hydrazinyl-3-pyridinyl)-(3,4-dimethylpyrrolidin-1-yl)methanone.
| Compound Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-(3,4-dimethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 79187114 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-(3,4-dimethylpyrrolidin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(Br)cnc2NN)CC1C |
| InChI | InChI=1S/C12H17BrN4O/c1-7-5-17(6-8(7)2)12(18)10-3-9(13)4-15-11(10)16-14/h3-4,7-8H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | PQFXMEGDMXNABX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|