C11H15BrN4O2 — CID 62969257
(5-bromo-2-hydrazinyl-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone (PubChem CID 62969257) has the molecular formula C11H15BrN4O2 and a molecular weight of 315.17 g/mol. Its IUPAC name is (5-bromo-2-hydrazinyl-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone.
| Compound Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 62969257 |
| Molecular Formula | C11H15BrN4O2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-(1,4-oxazepan-4-yl)methanone |
| SMILES | NNc1ncc(Br)cc1C(=O)N1CCCOCC1 |
| InChI | InChI=1S/C11H15BrN4O2/c12-8-6-9(10(15-13)14-7-8)11(17)16-2-1-4-18-5-3-16/h6-7H,1-5,13H2,(H,14,15) |
| InChIKey | JATPNSBTRYDZSB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|