C13H19BrN4O2 — CID 62243989
(5-bromo-2-hydrazinyl-3-pyridinyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 62243989) has the molecular formula C13H19BrN4O2 and a molecular weight of 343.23 g/mol. Its IUPAC name is (5-bromo-2-hydrazinyl-3-pyridinyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone.
| Compound Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 62243989 |
| Molecular Formula | C13H19BrN4O2 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (5-bromo-2-hydrazinyl-3-pyridinyl)-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | NNc1ncc(Br)cc1C(=O)N1CCCCC1CCO |
| InChI | InChI=1S/C13H19BrN4O2/c14-9-7-11(12(17-15)16-8-9)13(20)18-5-2-1-3-10(18)4-6-19/h7-8,10,19H,1-6,15H2,(H,16,17) |
| InChIKey | JANCDLZWAQOINZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|