C12H13N5O2 — CID 107075438
(2-amino-5-hydroxyphenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone (PubChem CID 107075438) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is (2-amino-5-hydroxyphenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone.
| Compound Name | (2-amino-5-hydroxyphenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
|---|---|
| PubChem CID | 107075438 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (2-amino-5-hydroxyphenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
| SMILES | Nc1ccc(O)cc1C(=O)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H13N5O2/c13-10-2-1-8(18)5-9(10)12(19)16-3-4-17-7-14-15-11(17)6-16/h1-2,5,7,18H,3-4,6,13H2 |
| InChIKey | YPASAJZYPNQYCM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|