C12H11Cl2N5O — CID 64581334
(3-amino-4,5-dichlorophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone (PubChem CID 64581334) has the molecular formula C12H11Cl2N5O and a molecular weight of 312.16 g/mol. Its IUPAC name is (3-amino-4,5-dichlorophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone.
| Compound Name | (3-amino-4,5-dichlorophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
|---|---|
| PubChem CID | 64581334 |
| Molecular Formula | C12H11Cl2N5O |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (3-amino-4,5-dichlorophenyl)-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)methanone |
| SMILES | Nc1cc(C(=O)N2CCn3cnnc3C2)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H11Cl2N5O/c13-8-3-7(4-9(15)11(8)14)12(20)18-1-2-19-6-16-17-10(19)5-18/h3-4,6H,1-2,5,15H2 |
| InChIKey | PHXGWIQBYAAENM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|