C12H15N5O4 — CID 64694171
4-(2-hydrazinyl-5-nitrobenzoyl)-1-methylpiperazin-2-one (PubChem CID 64694171) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-(2-hydrazinyl-5-nitrobenzoyl)-1-methylpiperazin-2-one.
| Compound Name | 4-(2-hydrazinyl-5-nitrobenzoyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 64694171 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-(2-hydrazinyl-5-nitrobenzoyl)-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C(=O)c2cc([N+](=O)[O-])ccc2NN)CC1=O |
| InChI | InChI=1S/C12H15N5O4/c1-15-4-5-16(7-11(15)18)12(19)9-6-8(17(20)21)2-3-10(9)14-13/h2-3,6,14H,4-5,7,13H2,1H3 |
| InChIKey | JKKFQDWSFDKOQB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|