C12H17N5O3 — CID 83024874
2-hydrazinyl-5-nitro-N-piperidin-1-ylbenzamide (PubChem CID 83024874) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-hydrazinyl-5-nitro-N-piperidin-1-ylbenzamide.
| Compound Name | 2-hydrazinyl-5-nitro-N-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 83024874 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-hydrazinyl-5-nitro-N-piperidin-1-ylbenzamide |
| SMILES | NNc1ccc([N+](=O)[O-])cc1C(=O)NN1CCCCC1 |
| InChI | InChI=1S/C12H17N5O3/c13-14-11-5-4-9(17(19)20)8-10(11)12(18)15-16-6-2-1-3-7-16/h4-5,8,14H,1-3,6-7,13H2,(H,15,18) |
| InChIKey | PSDYKIUPUHHLJW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|