C9H8N6O3S — CID 55052407
2-hydrazinyl-5-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 55052407) has the molecular formula C9H8N6O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-hydrazinyl-5-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-hydrazinyl-5-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55052407 |
| Molecular Formula | C9H8N6O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-hydrazinyl-5-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | NNc1ccc([N+](=O)[O-])cc1C(=O)Nc1nncs1 |
| InChI | InChI=1S/C9H8N6O3S/c10-13-7-2-1-5(15(17)18)3-6(7)8(16)12-9-14-11-4-19-9/h1-4,13H,10H2,(H,12,14,16) |
| InChIKey | JNVKRWIGNCTLJQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|