C8H4ClN5O3S — CID 113264937
2-chloro-5-nitro-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 113264937) has the molecular formula C8H4ClN5O3S and a molecular weight of 285.67 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-nitro-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113264937 |
| Molecular Formula | C8H4ClN5O3S |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 2-chloro-5-nitro-N-(1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nncs1)c1cc([N+](=O)[O-])cnc1Cl |
| InChI | InChI=1S/C8H4ClN5O3S/c9-6-5(1-4(2-10-6)14(16)17)7(15)12-8-13-11-3-18-8/h1-3H,(H,12,13,15) |
| InChIKey | OZVVIRUKMZTMQK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|