C15H14IN5O4S — CID 55957732
1-(2-iodo-5-nitrobenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55957732) has the molecular formula C15H14IN5O4S and a molecular weight of 487.28 g/mol. Its IUPAC name is 1-(2-iodo-5-nitrobenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(2-iodo-5-nitrobenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55957732 |
| Molecular Formula | C15H14IN5O4S |
| Molecular Weight | 487.28 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | 1-(2-iodo-5-nitrobenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nncs1)C1CCN(C(=O)c2cc([N+](=O)[O-])ccc2I)CC1 |
| InChI | InChI=1S/C15H14IN5O4S/c16-12-2-1-10(21(24)25)7-11(12)14(23)20-5-3-9(4-6-20)13(22)18-15-19-17-8-26-15/h1-2,7-9H,3-6H2,(H,18,19,22) |
| InChIKey | NUFGGWCMZLDOGF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|