C12H13N5O3S2 — CID 75471905
1-(3-nitrothiophen-2-yl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 75471905) has the molecular formula C12H13N5O3S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-(3-nitrothiophen-2-yl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3-nitrothiophen-2-yl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 75471905 |
| Molecular Formula | C12H13N5O3S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 1-(3-nitrothiophen-2-yl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nncs1)C1CCN(c2sccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H13N5O3S2/c18-10(14-12-15-13-7-22-12)8-1-4-16(5-2-8)11-9(17(19)20)3-6-21-11/h3,6-8H,1-2,4-5H2,(H,14,15,18) |
| InChIKey | FFPOUIQXDXEGHZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|