C18H22N4O2S — CID 60523272
1-(4-phenylbutanoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 60523272) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(4-phenylbutanoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(4-phenylbutanoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60523272 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(4-phenylbutanoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nncs1)C1CCN(C(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N4O2S/c23-16(8-4-7-14-5-2-1-3-6-14)22-11-9-15(10-12-22)17(24)20-18-21-19-13-25-18/h1-3,5-6,13,15H,4,7-12H2,(H,20,21,24) |
| InChIKey | OGFQOORZVBFKAT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |