C18H20Cl2N4O3S — CID 55957727
1-[4-(2,4-dichlorophenoxy)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 55957727) has the molecular formula C18H20Cl2N4O3S and a molecular weight of 443.36 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorophenoxy)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-[4-(2,4-dichlorophenoxy)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55957727 |
| Molecular Formula | C18H20Cl2N4O3S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 1-[4-(2,4-dichlorophenoxy)butanoyl]-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nncs1)C1CCN(C(=O)CCCOc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H20Cl2N4O3S/c19-13-3-4-15(14(20)10-13)27-9-1-2-16(25)24-7-5-12(6-8-24)17(26)22-18-23-21-11-28-18/h3-4,10-12H,1-2,5-9H2,(H,22,23,26) |
| InChIKey | JPTBJJANPHMFQQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|