C21H26N4O2S — CID 60523241
1-(4-cyclohexylbenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide (PubChem CID 60523241) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-(4-cyclohexylbenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(4-cyclohexylbenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60523241 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(4-cyclohexylbenzoyl)-N-(1,3,4-thiadiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nncs1)C1CCN(C(=O)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H26N4O2S/c26-19(23-21-24-22-14-28-21)17-10-12-25(13-11-17)20(27)18-8-6-16(7-9-18)15-4-2-1-3-5-15/h6-9,14-15,17H,1-5,10-13H2,(H,23,24,26) |
| InChIKey | QQDZLOQTRBLENK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |