C16H15IN4O5 — CID 55866995
[4-(2-iodo-5-nitrobenzoyl)piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone (PubChem CID 55866995) has the molecular formula C16H15IN4O5 and a molecular weight of 470.22 g/mol. Its IUPAC name is [4-(2-iodo-5-nitrobenzoyl)piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone.
| Compound Name | [4-(2-iodo-5-nitrobenzoyl)piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 55866995 |
| Molecular Formula | C16H15IN4O5 |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | [4-(2-iodo-5-nitrobenzoyl)piperazin-1-yl]-(3-methyl-1,2-oxazol-5-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3I)CC2)on1 |
| InChI | InChI=1S/C16H15IN4O5/c1-10-8-14(26-18-10)16(23)20-6-4-19(5-7-20)15(22)12-9-11(21(24)25)2-3-13(12)17/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | WMGAGDZKQNJFSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 109.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|