C17H20N4O5 — CID 87017671
(3-methyl-1,2-oxazol-5-yl)-[4-[2-(2-nitrophenoxy)ethyl]piperazin-1-yl]methanone (PubChem CID 87017671) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)-[4-[2-(2-nitrophenoxy)ethyl]piperazin-1-yl]methanone.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)-[4-[2-(2-nitrophenoxy)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 87017671 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)-[4-[2-(2-nitrophenoxy)ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCN(CCOc3ccccc3[N+](=O)[O-])CC2)on1 |
| InChI | InChI=1S/C17H20N4O5/c1-13-12-16(26-18-13)17(22)20-8-6-19(7-9-20)10-11-25-15-5-3-2-4-14(15)21(23)24/h2-5,12H,6-11H2,1H3 |
| InChIKey | KSGUNCHAEKYWQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|