C21H26N6O5 — CID 55839140
2-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 55839140) has the molecular formula C21H26N6O5 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55839140 |
| Molecular Formula | C21H26N6O5 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[4-(3-methyl-1,2-oxazole-5-carbonyl)piperazin-1-yl]-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(C(=O)N2CCN(CC(=O)N3CCN(c4ccccc4[N+](=O)[O-])CC3)CC2)on1 |
| InChI | InChI=1S/C21H26N6O5/c1-16-14-19(32-22-16)21(29)26-8-6-23(7-9-26)15-20(28)25-12-10-24(11-13-25)17-4-2-3-5-18(17)27(30)31/h2-5,14H,6-13,15H2,1H3 |
| InChIKey | UXLVBECXNGPEJA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 116.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|