C17H18N4O4 — CID 17420897
(5-cyclopropyl-1,2-oxazol-3-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 17420897) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-3-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (5-cyclopropyl-1,2-oxazol-3-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17420897 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-3-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(C2CC2)on1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H18N4O4/c22-17(13-11-16(25-18-13)12-5-6-12)20-9-7-19(8-10-20)14-3-1-2-4-15(14)21(23)24/h1-4,11-12H,5-10H2 |
| InChIKey | LPNVHBHLUMEDPD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|