C16H14Cl2N4O3 — CID 26783004
(3,6-dichloro-2-pyridinyl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 26783004) has the molecular formula C16H14Cl2N4O3 and a molecular weight of 381.22 g/mol. Its IUPAC name is (3,6-dichloro-2-pyridinyl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (3,6-dichloro-2-pyridinyl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26783004 |
| Molecular Formula | C16H14Cl2N4O3 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (3,6-dichloro-2-pyridinyl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H14Cl2N4O3/c17-11-5-6-14(18)19-15(11)16(23)21-9-7-20(8-10-21)12-3-1-2-4-13(12)22(24)25/h1-6H,7-10H2 |
| InChIKey | FSOWLWJAWXORDB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|