C20H20ClN3O5 — CID 26287038
(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 26287038) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26287038 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)c2c(c1)OCCCO2)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H20ClN3O5/c21-15-12-14(13-18-19(15)29-11-3-10-28-18)20(25)23-8-6-22(7-9-23)16-4-1-2-5-17(16)24(26)27/h1-2,4-5,12-13H,3,6-11H2 |
| InChIKey | AJGMPXNORQLZFW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|