C18H15BrN4O3S2 — CID 55929244
[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55929244) has the molecular formula C18H15BrN4O3S2 and a molecular weight of 479.38 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55929244 |
| Molecular Formula | C18H15BrN4O3S2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1csc(-c2cc(Br)cs2)n1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H15BrN4O3S2/c19-12-9-16(27-10-12)17-20-13(11-28-17)18(24)22-7-5-21(6-8-22)14-3-1-2-4-15(14)23(25)26/h1-4,9-11H,5-8H2 |
| InChIKey | WDCVSYDIZQBHAD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|