C19H15F3N4O3S2 — CID 32688287
[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone (PubChem CID 32688287) has the molecular formula C19H15F3N4O3S2 and a molecular weight of 468.48 g/mol. Its IUPAC name is [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone.
| Compound Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 32688287 |
| Molecular Formula | C19H15F3N4O3S2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-thiophen-2-yl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2cccs2)n1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H15F3N4O3S2/c20-19(21,22)12-3-4-14(15(10-12)26(28)29)24-5-7-25(8-6-24)18(27)13-11-31-17(23-13)16-2-1-9-30-16/h1-4,9-11H,5-8H2 |
| InChIKey | HZRJWYXOPDDAMS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|