C21H17F3N4O3S — CID 46823573
[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 46823573) has the molecular formula C21H17F3N4O3S and a molecular weight of 462.45 g/mol. Its IUPAC name is [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 46823573 |
| Molecular Formula | C21H17F3N4O3S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2ccccc2)n1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H17F3N4O3S/c22-21(23,24)15-6-7-17(18(12-15)28(30)31)26-8-10-27(11-9-26)20(29)16-13-32-19(25-16)14-4-2-1-3-5-14/h1-7,12-13H,8-11H2 |
| InChIKey | UYZZUOCUIYSJIR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|