C22H21F3N4O3S — CID 55354309
2-(3-methoxyphenyl)-4-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-thiazole (PubChem CID 55354309) has the molecular formula C22H21F3N4O3S and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-(3-methoxyphenyl)-4-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 55354309 |
| Molecular Formula | C22H21F3N4O3S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-(3-methoxyphenyl)-4-[[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1,3-thiazole |
| SMILES | COc1cccc(-c2nc(CN3CCN(c4ccc(C(F)(F)F)cc4[N+](=O)[O-])CC3)cs2)c1 |
| InChI | InChI=1S/C22H21F3N4O3S/c1-32-18-4-2-3-15(11-18)21-26-17(14-33-21)13-27-7-9-28(10-8-27)19-6-5-16(22(23,24)25)12-20(19)29(30)31/h2-6,11-12,14H,7-10,13H2,1H3 |
| InChIKey | AEYAZXCZUBJCHZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|