C11H12FNO3 — CID 126772952
(5-fluoro-2-hydroxyphenyl)-(1,3-oxazinan-3-yl)methanone (PubChem CID 126772952) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is (5-fluoro-2-hydroxyphenyl)-(1,3-oxazinan-3-yl)methanone.
| Compound Name | (5-fluoro-2-hydroxyphenyl)-(1,3-oxazinan-3-yl)methanone |
|---|---|
| PubChem CID | 126772952 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (5-fluoro-2-hydroxyphenyl)-(1,3-oxazinan-3-yl)methanone |
| SMILES | O=C(c1cc(F)ccc1O)N1CCCOC1 |
| InChI | InChI=1S/C11H12FNO3/c12-8-2-3-10(14)9(6-8)11(15)13-4-1-5-16-7-13/h2-3,6,14H,1,4-5,7H2 |
| InChIKey | TUCCACCRPNUZHR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |