C15H20Cl2FN3O — CID 120995650
(4-chloro-2-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120995650) has the molecular formula C15H20Cl2FN3O and a molecular weight of 348.25 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (4-chloro-2-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120995650 |
| Molecular Formula | C15H20Cl2FN3O |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Cl)cc1F)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C15H19ClFN3O.ClH/c16-11-1-2-13(14(17)9-11)15(21)20-6-3-12(10-20)19-7-4-18-5-8-19;/h1-2,9,12,18H,3-8,10H2;1H |
| InChIKey | KALHCTZWIYUFQI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |