C17H22Cl2FN3O2 — CID 119316403
[4-(4-chloro-2-fluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone;hydrochloride (PubChem CID 119316403) has the molecular formula C17H22Cl2FN3O2 and a molecular weight of 390.29 g/mol. Its IUPAC name is [4-(4-chloro-2-fluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone;hydrochloride.
| Compound Name | [4-(4-chloro-2-fluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119316403 |
| Molecular Formula | C17H22Cl2FN3O2 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [4-(4-chloro-2-fluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Cl)cc1F)N1CCN(C(=O)C2CCNCC2)CC1 |
| InChI | InChI=1S/C17H21ClFN3O2.ClH/c18-13-1-2-14(15(19)11-13)17(24)22-9-7-21(8-10-22)16(23)12-3-5-20-6-4-12;/h1-2,11-12,20H,3-10H2;1H |
| InChIKey | MNFVAOQKEIAQNC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |