C14H17ClIN3O — CID 103209579
(3-chloro-4-iodophenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone (PubChem CID 103209579) has the molecular formula C14H17ClIN3O and a molecular weight of 405.67 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone.
| Compound Name | (3-chloro-4-iodophenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 103209579 |
| Molecular Formula | C14H17ClIN3O |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(3-piperazin-1-ylazetidin-1-yl)methanone |
| SMILES | O=C(c1ccc(I)c(Cl)c1)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C14H17ClIN3O/c15-12-7-10(1-2-13(12)16)14(20)19-8-11(9-19)18-5-3-17-4-6-18/h1-2,7,11,17H,3-6,8-9H2 |
| InChIKey | BVSWZBWBEWAENC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|