C14H17Cl2IN2O — CID 119638925
(3-chloro-4-iodophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride (PubChem CID 119638925) has the molecular formula C14H17Cl2IN2O and a molecular weight of 427.11 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride.
| Compound Name | (3-chloro-4-iodophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119638925 |
| Molecular Formula | C14H17Cl2IN2O |
| Molecular Weight | 427.11 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(3,9-diazabicyclo[4.2.1]nonan-3-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(I)c(Cl)c1)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C14H16ClIN2O.ClH/c15-12-7-9(1-4-13(12)16)14(19)18-6-5-10-2-3-11(8-18)17-10;/h1,4,7,10-11,17H,2-3,5-6,8H2;1H |
| InChIKey | MOBLLADLSWMTQY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|