C12H17N5O3 — CID 66202057
6-(3-piperazin-1-ylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 66202057) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-(3-piperazin-1-ylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-piperazin-1-ylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66202057 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 6-(3-piperazin-1-ylazetidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C12H17N5O3/c18-10-5-9(14-12(20)15-10)11(19)17-6-8(7-17)16-3-1-13-2-4-16/h5,8,13H,1-4,6-7H2,(H2,14,15,18,20) |
| InChIKey | WFNGLAXHYKGHIW-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |