C11H16N4O4 — CID 115315193
6-[2-(1-aminoethyl)morpholine-4-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 115315193) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 6-[2-(1-aminoethyl)morpholine-4-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-(1-aminoethyl)morpholine-4-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115315193 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 6-[2-(1-aminoethyl)morpholine-4-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | CC(N)C1CN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)CCO1 |
| InChI | InChI=1S/C11H16N4O4/c1-6(12)8-5-15(2-3-19-8)10(17)7-4-9(16)14-11(18)13-7/h4,6,8H,2-3,5,12H2,1H3,(H2,13,14,16,18) |
| InChIKey | WCEXMLSQDGKQAI-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |