C10H14N4O3 — CID 61297937
6-(3-aminopiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 61297937) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-(3-aminopiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-aminopiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 61297937 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-(3-aminopiperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | NC1CCCN(C(=O)c2cc(=O)[nH]c(=O)[nH]2)C1 |
| InChI | InChI=1S/C10H14N4O3/c11-6-2-1-3-14(5-6)9(16)7-4-8(15)13-10(17)12-7/h4,6H,1-3,5,11H2,(H2,12,13,15,17) |
| InChIKey | YJWRTNJCQPQTKY-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |