C17H18ClN3O3 — CID 121146641
6-[3-(4-chlorophenyl)azepane-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 121146641) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 6-[3-(4-chlorophenyl)azepane-1-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[3-(4-chlorophenyl)azepane-1-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121146641 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 6-[3-(4-chlorophenyl)azepane-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H18ClN3O3/c18-13-6-4-11(5-7-13)12-3-1-2-8-21(10-12)16(23)14-9-15(22)20-17(24)19-14/h4-7,9,12H,1-3,8,10H2,(H2,19,20,22,24) |
| InChIKey | WOOMXCAKCGKSIL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |