C15H18Cl2N4O — CID 119377654
(3-aminopiperidin-1-yl)-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone;hydrochloride (PubChem CID 119377654) has the molecular formula C15H18Cl2N4O and a molecular weight of 341.24 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119377654 |
| Molecular Formula | C15H18Cl2N4O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)c2cc(-c3ccc(Cl)cc3)n[nH]2)C1 |
| InChI | InChI=1S/C15H17ClN4O.ClH/c16-11-5-3-10(4-6-11)13-8-14(19-18-13)15(21)20-7-1-2-12(17)9-20;/h3-6,8,12H,1-2,7,9,17H2,(H,18,19);1H |
| InChIKey | YKIANKUYUMHPTF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |