C15H17ClN4O — CID 124611221
[(3R)-3-(aminomethyl)pyrrolidin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 124611221) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is [(3R)-3-(aminomethyl)pyrrolidin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [(3R)-3-(aminomethyl)pyrrolidin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 124611221 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [(3R)-3-(aminomethyl)pyrrolidin-1-yl]-[3-(4-chlorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | NC[C@H]1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n[nH]2)C1 |
| InChI | InChI=1S/C15H17ClN4O/c16-12-3-1-11(2-4-12)13-7-14(19-18-13)15(21)20-6-5-10(8-17)9-20/h1-4,7,10H,5-6,8-9,17H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | RLGNXXOEQIFMLQ-SNVBAGLBSA-N |
| XLogP | 2.15 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |