C20H21N5O3 — CID 95218749
6-[(3R)-3-(4-benzyl-1H-pyrazol-5-yl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 95218749) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-[(3R)-3-(4-benzyl-1H-pyrazol-5-yl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(3R)-3-(4-benzyl-1H-pyrazol-5-yl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 95218749 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 6-[(3R)-3-(4-benzyl-1H-pyrazol-5-yl)piperidine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCC[C@@H](c2[nH]ncc2Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H21N5O3/c26-17-10-16(22-20(28)23-17)19(27)25-8-4-7-14(12-25)18-15(11-21-24-18)9-13-5-2-1-3-6-13/h1-3,5-6,10-11,14H,4,7-9,12H2,(H,21,24)(H2,22,23,26,28)/t14-/m1/s1 |
| InChIKey | PKJAUTRROVCTOZ-CQSZACIVSA-N |
| XLogP | 1.40 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |