C20H25N3O2 — CID 126467483
[3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 126467483) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is [3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 126467483 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | [3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(C1CCCO1)N1CCCC(c2[nH]ncc2Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3O2/c24-20(18-9-5-11-25-18)23-10-4-8-16(14-23)19-17(13-21-22-19)12-15-6-2-1-3-7-15/h1-3,6-7,13,16,18H,4-5,8-12,14H2,(H,21,22) |
| InChIKey | XMXBMMQJPHTCJT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |