C21H29N3 — CID 56855128
3-(4-benzyl-1H-pyrazol-5-yl)-1-cyclohexylpiperidine (PubChem CID 56855128) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-(4-benzyl-1H-pyrazol-5-yl)-1-cyclohexylpiperidine.
| Compound Name | 3-(4-benzyl-1H-pyrazol-5-yl)-1-cyclohexylpiperidine |
|---|---|
| PubChem CID | 56855128 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 3-(4-benzyl-1H-pyrazol-5-yl)-1-cyclohexylpiperidine |
| SMILES | c1ccc(Cc2cn[nH]c2C2CCCN(C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C21H29N3/c1-3-8-17(9-4-1)14-19-15-22-23-21(19)18-10-7-13-24(16-18)20-11-5-2-6-12-20/h1,3-4,8-9,15,18,20H,2,5-7,10-14,16H2,(H,22,23) |
| InChIKey | UTVISMSGZAZONE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |