C19H21N5 — CID 56722746
2-[3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]pyrazine (PubChem CID 56722746) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-[3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]pyrazine.
| Compound Name | 2-[3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 56722746 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[3-(4-benzyl-1H-pyrazol-5-yl)piperidin-1-yl]pyrazine |
| SMILES | c1ccc(Cc2cn[nH]c2C2CCCN(c3cnccn3)C2)cc1 |
| InChI | InChI=1S/C19H21N5/c1-2-5-15(6-3-1)11-17-12-22-23-19(17)16-7-4-10-24(14-16)18-13-20-8-9-21-18/h1-3,5-6,8-9,12-13,16H,4,7,10-11,14H2,(H,22,23) |
| InChIKey | RQXKYSBMLTWEMG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |