C14H16N4 — CID 95817344
2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyrazine (PubChem CID 95817344) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyrazine.
| Compound Name | 2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 95817344 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[(3S)-3-pyridin-2-ylpiperidin-1-yl]pyrazine |
| SMILES | c1ccc([C@H]2CCCN(c3cnccn3)C2)nc1 |
| InChI | InChI=1S/C14H16N4/c1-2-6-16-13(5-1)12-4-3-9-18(11-12)14-10-15-7-8-17-14/h1-2,5-8,10,12H,3-4,9,11H2/t12-/m0/s1 |
| InChIKey | JVZWBGRLHKZKDD-LBPRGKRZSA-N |
| XLogP | 2.26 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |